C22H40N2O3 — CID 176920136
tert-butyl N-[(4-amino-3-octoxyphenyl)methyl]carbamate;ethane (PubChem CID 176920136) has the molecular formula C22H40N2O3 and a molecular weight of 380.57 g/mol. Its IUPAC name is tert-butyl N-[(4-amino-3-octoxyphenyl)methyl]carbamate;ethane.
| Compound Name | tert-butyl N-[(4-amino-3-octoxyphenyl)methyl]carbamate;ethane |
|---|---|
| PubChem CID | 176920136 |
| Molecular Formula | C22H40N2O3 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.30 |
| IUPAC Name | tert-butyl N-[(4-amino-3-octoxyphenyl)methyl]carbamate;ethane |
| SMILES | CC.CCCCCCCCOc1cc(CNC(=O)OC(C)(C)C)ccc1N |
| InChI | InChI=1S/C20H34N2O3.C2H6/c1-5-6-7-8-9-10-13-24-18-14-16(11-12-17(18)21)15-22-19(23)25-20(2,3)4;1-2/h11-12,14H,5-10,13,15,21H2,1-4H3,(H,22,23);1-2H3 |
| InChIKey | OVNMBBOGNUGANM-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|