About tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane
tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane (PubChem CID 176919939) has the molecular formula C21H38N2O3
and a molecular weight of 366.55 g/mol. Its IUPAC name is tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane.
Molecular Properties
| Compound Name | tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane |
| PubChem CID | 176919939 |
| Molecular Formula | C21H38N2O3 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.29 |
| IUPAC Name | tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane |
| SMILES | CC.CCCCCCCOc1cc(CNC(=O)OC(C)(C)C)ccc1N |
| InChI | InChI=1S/C19H32N2O3.C2H6/c1-5-6-7-8-9-12-23-17-13-15(10-11-16(17)20)14-21-18(22)24-19(2,3)4;1-2/h10-11,13H,5-9,12,14,20H2,1-4H3,(H,21,22);1-2H3 |
| InChIKey | DQMUVHGQKYZAMY-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane?
The IUPAC name of tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane (CID 176919939) is tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane.
What is the SMILES notation for tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane?
The canonical SMILES for tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane is CC.CCCCCCCOc1cc(CNC(=O)OC(C)(C)C)ccc1N.
What is the InChIKey of tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane?
The InChIKey is DQMUVHGQKYZAMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O3.C2H6/c1-5-6-7-8-9-12-23-17-13-15(10-11-16(17)20)14-21-18(22)24-19(2,3)4;1-2/h10-11,13H,5-9,12,14,20H2,1-4H3,(H,21,22);1-2H3.
What are the key properties of tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane?
tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane has a molecular weight of 366.55 g/mol, XLogP of 5.67, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[(4-amino-3-heptoxyphenyl)methyl]carbamate;ethane is sourced from PubChem (CID 176919939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).