C18H31BrN2O4 — CID 10549988
2-[2-methoxy-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenoxy]ethyl-trimethylazanium bromide (PubChem CID 10549988) has the molecular formula C18H31BrN2O4 and a molecular weight of 419.36 g/mol. Its IUPAC name is 2-[2-methoxy-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenoxy]ethyl-trimethylazanium bromide.
| Compound Name | 2-[2-methoxy-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenoxy]ethyl-trimethylazanium bromide |
|---|---|
| PubChem CID | 10549988 |
| Molecular Formula | C18H31BrN2O4 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 2-[2-methoxy-4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenoxy]ethyl-trimethylazanium bromide |
| SMILES | COc1cc(CNC(=O)OC(C)(C)C)ccc1OCC[N+](C)(C)C.[Br-] |
| InChI | InChI=1S/C18H30N2O4.BrH/c1-18(2,3)24-17(21)19-13-14-8-9-15(16(12-14)22-7)23-11-10-20(4,5)6;/h8-9,12H,10-11,13H2,1-7H3;1H |
| InChIKey | IGRBYGYIZQYJGV-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|