C18H25ClN2O8 — CID 151891872
tert-butyl 3-[2-[2-(5-carbamoyl-2-chloro-3-nitrophenoxy)ethoxy]ethoxy]propanoate (PubChem CID 151891872) has the molecular formula C18H25ClN2O8 and a molecular weight of 432.86 g/mol. Its IUPAC name is tert-butyl 3-[2-[2-(5-carbamoyl-2-chloro-3-nitrophenoxy)ethoxy]ethoxy]propanoate.
| Compound Name | tert-butyl 3-[2-[2-(5-carbamoyl-2-chloro-3-nitrophenoxy)ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 151891872 |
| Molecular Formula | C18H25ClN2O8 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | tert-butyl 3-[2-[2-(5-carbamoyl-2-chloro-3-nitrophenoxy)ethoxy]ethoxy]propanoate |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOc1cc(C(N)=O)cc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C18H25ClN2O8/c1-18(2,3)29-15(22)4-5-26-6-7-27-8-9-28-14-11-12(17(20)23)10-13(16(14)19)21(24)25/h10-11H,4-9H2,1-3H3,(H2,20,23) |
| InChIKey | SQXAWQHWOIXDCO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|