C23H24Cl2N2O11 — CID 155588880
ethyl 4-chloro-3-[(2S)-3-[2-chloro-5-[(2-methylpropan-2-yl)oxycarbonyl]-3-nitrophenoxy]-2-hydroxypropoxy]-5-nitrobenzoate (PubChem CID 155588880) has the molecular formula C23H24Cl2N2O11 and a molecular weight of 575.35 g/mol. Its IUPAC name is ethyl 4-chloro-3-[(2S)-3-[2-chloro-5-[(2-methylpropan-2-yl)oxycarbonyl]-3-nitrophenoxy]-2-hydroxypropoxy]-5-nitrobenzoate.
| Compound Name | ethyl 4-chloro-3-[(2S)-3-[2-chloro-5-[(2-methylpropan-2-yl)oxycarbonyl]-3-nitrophenoxy]-2-hydroxypropoxy]-5-nitrobenzoate |
|---|---|
| PubChem CID | 155588880 |
| Molecular Formula | C23H24Cl2N2O11 |
| Molecular Weight | 575.35 g/mol |
| Exact Mass | 574.08 |
| IUPAC Name | ethyl 4-chloro-3-[(2S)-3-[2-chloro-5-[(2-methylpropan-2-yl)oxycarbonyl]-3-nitrophenoxy]-2-hydroxypropoxy]-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(OC[C@H](O)COc2cc(C(=O)OC(C)(C)C)cc([N+](=O)[O-])c2Cl)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H24Cl2N2O11/c1-5-35-21(29)12-6-15(26(31)32)19(24)17(8-12)36-10-14(28)11-37-18-9-13(22(30)38-23(2,3)4)7-16(20(18)25)27(33)34/h6-9,14,28H,5,10-11H2,1-4H3/t14-/m0/s1 |
| InChIKey | VLWXILJLONTXEJ-AWEZNQCLSA-N |
| XLogP | 4.76 |
| TPSA | 177.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|