C12H13ClN2O5 — CID 157231306
3-[(2S)-2-aminopent-4-enoxy]-4-chloro-5-nitrobenzoic acid (PubChem CID 157231306) has the molecular formula C12H13ClN2O5 and a molecular weight of 300.70 g/mol. Its IUPAC name is 3-[(2S)-2-aminopent-4-enoxy]-4-chloro-5-nitrobenzoic acid.
| Compound Name | 3-[(2S)-2-aminopent-4-enoxy]-4-chloro-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 157231306 |
| Molecular Formula | C12H13ClN2O5 |
| Molecular Weight | 300.70 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 3-[(2S)-2-aminopent-4-enoxy]-4-chloro-5-nitrobenzoic acid |
| SMILES | C=CC[C@H](N)COc1cc(C(=O)O)cc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C12H13ClN2O5/c1-2-3-8(14)6-20-10-5-7(12(16)17)4-9(11(10)13)15(18)19/h2,4-5,8H,1,3,6,14H2,(H,16,17)/t8-/m0/s1 |
| InChIKey | AUDFBUBPZLWMAF-QMMMGPOBSA-N |
| XLogP | 2.23 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.70 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|