C20H23ClN4O6 — CID 162233184
benzyl N-[4-amino-5-(5-carbamoyl-2-chloro-3-nitrophenoxy)pentyl]carbamate (PubChem CID 162233184) has the molecular formula C20H23ClN4O6 and a molecular weight of 450.88 g/mol. Its IUPAC name is benzyl N-[4-amino-5-(5-carbamoyl-2-chloro-3-nitrophenoxy)pentyl]carbamate.
| Compound Name | benzyl N-[4-amino-5-(5-carbamoyl-2-chloro-3-nitrophenoxy)pentyl]carbamate |
|---|---|
| PubChem CID | 162233184 |
| Molecular Formula | C20H23ClN4O6 |
| Molecular Weight | 450.88 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | benzyl N-[4-amino-5-(5-carbamoyl-2-chloro-3-nitrophenoxy)pentyl]carbamate |
| SMILES | NC(=O)c1cc(OCC(N)CCCNC(=O)OCc2ccccc2)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H23ClN4O6/c21-18-16(25(28)29)9-14(19(23)26)10-17(18)30-12-15(22)7-4-8-24-20(27)31-11-13-5-2-1-3-6-13/h1-3,5-6,9-10,15H,4,7-8,11-12,22H2,(H2,23,26)(H,24,27) |
| InChIKey | ZVSCNNZMNPGBOT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 159.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.88 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|