C15H23N3O4 — CID 89221237
benzyl N-[(4S)-4-amino-6-[hydroxy(methyl)amino]-6-oxohexyl]carbamate (PubChem CID 89221237) has the molecular formula C15H23N3O4 and a molecular weight of 309.37 g/mol. Its IUPAC name is benzyl N-[(4S)-4-amino-6-[hydroxy(methyl)amino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(4S)-4-amino-6-[hydroxy(methyl)amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 89221237 |
| Molecular Formula | C15H23N3O4 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | benzyl N-[(4S)-4-amino-6-[hydroxy(methyl)amino]-6-oxohexyl]carbamate |
| SMILES | CN(O)C(=O)C[C@@H](N)CCCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H23N3O4/c1-18(21)14(19)10-13(16)8-5-9-17-15(20)22-11-12-6-3-2-4-7-12/h2-4,6-7,13,21H,5,8-11,16H2,1H3,(H,17,20)/t13-/m0/s1 |
| InChIKey | KZUMSXQJMMFEJK-ZDUSSCGKSA-N |
| XLogP | 1.26 |
| TPSA | 104.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|