C17H25ClN2O5 — CID 153387174
ethane;methyl 3-(4-aminohept-6-enoxy)-4-chloro-5-nitrobenzoate (PubChem CID 153387174) has the molecular formula C17H25ClN2O5 and a molecular weight of 372.85 g/mol. Its IUPAC name is ethane;methyl 3-(4-aminohept-6-enoxy)-4-chloro-5-nitrobenzoate.
| Compound Name | ethane;methyl 3-(4-aminohept-6-enoxy)-4-chloro-5-nitrobenzoate |
|---|---|
| PubChem CID | 153387174 |
| Molecular Formula | C17H25ClN2O5 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | ethane;methyl 3-(4-aminohept-6-enoxy)-4-chloro-5-nitrobenzoate |
| SMILES | C=CCC(N)CCCOc1cc(C(=O)OC)cc([N+](=O)[O-])c1Cl.CC |
| InChI | InChI=1S/C15H19ClN2O5.C2H6/c1-3-5-11(17)6-4-7-23-13-9-10(15(19)22-2)8-12(14(13)16)18(20)21;1-2/h3,8-9,11H,1,4-7,17H2,2H3;1-2H3 |
| InChIKey | QDDHZPKUJWFZSB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 104.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|