C20H29ClN2O8 — CID 154638927
methyl 4-chloro-3-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]butoxy]-5-nitrobenzoate (PubChem CID 154638927) has the molecular formula C20H29ClN2O8 and a molecular weight of 460.91 g/mol. Its IUPAC name is methyl 4-chloro-3-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]butoxy]-5-nitrobenzoate.
| Compound Name | methyl 4-chloro-3-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]butoxy]-5-nitrobenzoate |
|---|---|
| PubChem CID | 154638927 |
| Molecular Formula | C20H29ClN2O8 |
| Molecular Weight | 460.91 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | methyl 4-chloro-3-[3-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]butoxy]-5-nitrobenzoate |
| SMILES | COC(=O)c1cc(OCCC(C)OCCCNC(=O)OC(C)(C)C)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H29ClN2O8/c1-13(29-9-6-8-22-19(25)31-20(2,3)4)7-10-30-16-12-14(18(24)28-5)11-15(17(16)21)23(26)27/h11-13H,6-10H2,1-5H3,(H,22,25) |
| InChIKey | MFMXVZLJQJDGKS-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 126.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.91 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|