C19H21ClN2O7 — CID 168843653
tert-butyl 3-[3-(2-chloro-5-methoxycarbonyl-3-nitrophenoxy)prop-1-ynyl]azetidine-1-carboxylate (PubChem CID 168843653) has the molecular formula C19H21ClN2O7 and a molecular weight of 424.84 g/mol. Its IUPAC name is tert-butyl 3-[3-(2-chloro-5-methoxycarbonyl-3-nitrophenoxy)prop-1-ynyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[3-(2-chloro-5-methoxycarbonyl-3-nitrophenoxy)prop-1-ynyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 168843653 |
| Molecular Formula | C19H21ClN2O7 |
| Molecular Weight | 424.84 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | tert-butyl 3-[3-(2-chloro-5-methoxycarbonyl-3-nitrophenoxy)prop-1-ynyl]azetidine-1-carboxylate |
| SMILES | COC(=O)c1cc(OCC#CC2CN(C(=O)OC(C)(C)C)C2)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21ClN2O7/c1-19(2,3)29-18(24)21-10-12(11-21)6-5-7-28-15-9-13(17(23)27-4)8-14(16(15)20)22(25)26/h8-9,12H,7,10-11H2,1-4H3 |
| InChIKey | SUZVLIAXGSIAJL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.84 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|