C17H23ClN3O6+ — CID 164588044
[4-chloro-3-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]ethoxy]-5-nitrobenzoyl]azanium (PubChem CID 164588044) has the molecular formula C17H23ClN3O6+ and a molecular weight of 400.84 g/mol. Its IUPAC name is [4-chloro-3-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]ethoxy]-5-nitrobenzoyl]azanium.
| Compound Name | [4-chloro-3-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]ethoxy]-5-nitrobenzoyl]azanium |
|---|---|
| PubChem CID | 164588044 |
| Molecular Formula | C17H23ClN3O6+ |
| Molecular Weight | 400.84 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | [4-chloro-3-[2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]ethoxy]-5-nitrobenzoyl]azanium |
| SMILES | CC(C)(C)OC(=O)N1CC(CCOc2cc(C([NH3+])=O)cc([N+](=O)[O-])c2Cl)C1 |
| InChI | InChI=1S/C17H22ClN3O6/c1-17(2,3)27-16(23)20-8-10(9-20)4-5-26-13-7-11(15(19)22)6-12(14(13)18)21(24)25/h6-7,10H,4-5,8-9H2,1-3H3,(H2,19,22)/p+1 |
| InChIKey | GOSAACBPNKPQOH-UHFFFAOYSA-O |
| XLogP | 2.27 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.84 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|