C27H33N7O6 — CID 167434702
tert-butyl 3-[2-[5-carbamoyl-3-[2-(2-ethyl-5-methylpyrazol-3-yl)pyrimidin-5-yl]-2-nitrophenoxy]ethyl]azetidine-1-carboxylate (PubChem CID 167434702) has the molecular formula C27H33N7O6 and a molecular weight of 551.60 g/mol. Its IUPAC name is tert-butyl 3-[2-[5-carbamoyl-3-[2-(2-ethyl-5-methylpyrazol-3-yl)pyrimidin-5-yl]-2-nitrophenoxy]ethyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[5-carbamoyl-3-[2-(2-ethyl-5-methylpyrazol-3-yl)pyrimidin-5-yl]-2-nitrophenoxy]ethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 167434702 |
| Molecular Formula | C27H33N7O6 |
| Molecular Weight | 551.60 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | tert-butyl 3-[2-[5-carbamoyl-3-[2-(2-ethyl-5-methylpyrazol-3-yl)pyrimidin-5-yl]-2-nitrophenoxy]ethyl]azetidine-1-carboxylate |
| SMILES | CCn1nc(C)cc1-c1ncc(-c2cc(C(N)=O)cc(OCCC3CN(C(=O)OC(C)(C)C)C3)c2[N+](=O)[O-])cn1 |
| InChI | InChI=1S/C27H33N7O6/c1-6-33-21(9-16(2)31-33)25-29-12-19(13-30-25)20-10-18(24(28)35)11-22(23(20)34(37)38)39-8-7-17-14-32(15-17)26(36)40-27(3,4)5/h9-13,17H,6-8,14-15H2,1-5H3,(H2,28,35) |
| InChIKey | FYKXARSMBZIMAE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 168.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.60 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|