C34H43ClN2O7Si — CID 162163022
tert-butyl N-[5-(5-acetyl-2-chloro-3-nitrophenoxy)-1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]carbamate (PubChem CID 162163022) has the molecular formula C34H43ClN2O7Si and a molecular weight of 655.26 g/mol. Its IUPAC name is tert-butyl N-[5-(5-acetyl-2-chloro-3-nitrophenoxy)-1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-(5-acetyl-2-chloro-3-nitrophenoxy)-1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]carbamate |
|---|---|
| PubChem CID | 162163022 |
| Molecular Formula | C34H43ClN2O7Si |
| Molecular Weight | 655.26 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | tert-butyl N-[5-(5-acetyl-2-chloro-3-nitrophenoxy)-1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]carbamate |
| SMILES | CC(=O)c1cc(OCCCC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)NC(=O)OC(C)(C)C)c(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C34H43ClN2O7Si/c1-24(38)25-21-29(37(40)41)31(35)30(22-25)42-20-14-15-26(36-32(39)44-33(2,3)4)23-43-45(34(5,6)7,27-16-10-8-11-17-27)28-18-12-9-13-19-28/h8-13,16-19,21-22,26H,14-15,20,23H2,1-7H3,(H,36,39) |
| InChIKey | GBRDYTGKSLLLQF-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.26 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|