C41H55NO5Si — CID 177422485
tert-butyl N-[(2S)-13-[tert-butyl(diphenyl)silyl]oxy-5-oxo-1-phenylmethoxytridec-9-yn-2-yl]carbamate (PubChem CID 177422485) has the molecular formula C41H55NO5Si and a molecular weight of 669.98 g/mol. Its IUPAC name is tert-butyl N-[(2S)-13-[tert-butyl(diphenyl)silyl]oxy-5-oxo-1-phenylmethoxytridec-9-yn-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-13-[tert-butyl(diphenyl)silyl]oxy-5-oxo-1-phenylmethoxytridec-9-yn-2-yl]carbamate |
|---|---|
| PubChem CID | 177422485 |
| Molecular Formula | C41H55NO5Si |
| Molecular Weight | 669.98 g/mol |
| Exact Mass | 669.38 |
| IUPAC Name | tert-butyl N-[(2S)-13-[tert-butyl(diphenyl)silyl]oxy-5-oxo-1-phenylmethoxytridec-9-yn-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCC(=O)CCCC#CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)COCc1ccccc1 |
| InChI | InChI=1S/C41H55NO5Si/c1-40(2,3)47-39(44)42-35(33-45-32-34-22-14-11-15-23-34)29-30-36(43)24-16-9-7-8-10-21-31-46-48(41(4,5)6,37-25-17-12-18-26-37)38-27-19-13-20-28-38/h11-15,17-20,22-23,25-28,35H,9-10,16,21,24,29-33H2,1-6H3,(H,42,44)/t35-/m0/s1 |
| InChIKey | CKWGBFFRZNWNIS-DHUJRADRSA-N |
| XLogP | 7.98 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.98 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|