C30H47NO4Si — CID 58330007
tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-ethyl-7-hydroxyheptan-2-yl]carbamate (PubChem CID 58330007) has the molecular formula C30H47NO4Si and a molecular weight of 513.80 g/mol. Its IUPAC name is tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-ethyl-7-hydroxyheptan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-ethyl-7-hydroxyheptan-2-yl]carbamate |
|---|---|
| PubChem CID | 58330007 |
| Molecular Formula | C30H47NO4Si |
| Molecular Weight | 513.80 g/mol |
| Exact Mass | 513.33 |
| IUPAC Name | tert-butyl N-[(2S,4R)-1-[tert-butyl(diphenyl)silyl]oxy-4-ethyl-7-hydroxyheptan-2-yl]carbamate |
| SMILES | CC[C@H](CCCO)C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H47NO4Si/c1-8-24(16-15-21-32)22-25(31-28(33)35-29(2,3)4)23-34-36(30(5,6)7,26-17-11-9-12-18-26)27-19-13-10-14-20-27/h9-14,17-20,24-25,32H,8,15-16,21-23H2,1-7H3,(H,31,33)/t24-,25+/m1/s1 |
| InChIKey | DOWZDHKMNWUHLV-RPBOFIJWSA-N |
| XLogP | 5.65 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.80 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|