C27H40N2O4Si — CID 10576853
tert-butyl N-[(2S)-1-[[tert-butyl(diphenyl)silyl]oxyamino]-4-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 10576853) has the molecular formula C27H40N2O4Si and a molecular weight of 484.71 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[tert-butyl(diphenyl)silyl]oxyamino]-4-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[tert-butyl(diphenyl)silyl]oxyamino]-4-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 10576853 |
| Molecular Formula | C27H40N2O4Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[tert-butyl(diphenyl)silyl]oxyamino]-4-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](NC(=O)OC(C)(C)C)C(=O)NO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H40N2O4Si/c1-20(2)19-23(28-25(31)32-26(3,4)5)24(30)29-33-34(27(6,7)8,21-15-11-9-12-16-21)22-17-13-10-14-18-22/h9-18,20,23H,19H2,1-8H3,(H,28,31)(H,29,30)/t23-/m0/s1 |
| InChIKey | WLRTUOCXFWPJET-QHCPKHFHSA-N |
| XLogP | 4.53 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|