C18H25NO4S — CID 141164573
benzenecarbonothioyl 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 141164573) has the molecular formula C18H25NO4S and a molecular weight of 351.47 g/mol. Its IUPAC name is benzenecarbonothioyl 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | benzenecarbonothioyl 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 141164573 |
| Molecular Formula | C18H25NO4S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | benzenecarbonothioyl 4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)CC(NC(=O)OC(C)(C)C)C(=O)OC(=S)c1ccccc1 |
| InChI | InChI=1S/C18H25NO4S/c1-12(2)11-14(19-17(21)23-18(3,4)5)15(20)22-16(24)13-9-7-6-8-10-13/h6-10,12,14H,11H2,1-5H3,(H,19,21) |
| InChIKey | WNWOJTFMZGDFNM-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|