C19H27ClN6O6 — CID 171561507
tert-butyl N-[(Z)-2-amino-3-[amino-[(E)-4-(5-carbamoyl-2-chloro-3-nitrophenoxy)but-2-enyl]amino]prop-2-enyl]carbamate (PubChem CID 171561507) has the molecular formula C19H27ClN6O6 and a molecular weight of 470.91 g/mol. Its IUPAC name is tert-butyl N-[(Z)-2-amino-3-[amino-[(E)-4-(5-carbamoyl-2-chloro-3-nitrophenoxy)but-2-enyl]amino]prop-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-2-amino-3-[amino-[(E)-4-(5-carbamoyl-2-chloro-3-nitrophenoxy)but-2-enyl]amino]prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 171561507 |
| Molecular Formula | C19H27ClN6O6 |
| Molecular Weight | 470.91 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | tert-butyl N-[(Z)-2-amino-3-[amino-[(E)-4-(5-carbamoyl-2-chloro-3-nitrophenoxy)but-2-enyl]amino]prop-2-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC/C(N)=C/N(N)C/C=C/COc1cc(C(N)=O)cc([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C19H27ClN6O6/c1-19(2,3)32-18(28)24-10-13(21)11-25(23)6-4-5-7-31-15-9-12(17(22)27)8-14(16(15)20)26(29)30/h4-5,8-9,11H,6-7,10,21,23H2,1-3H3,(H2,22,27)(H,24,28)/b5-4+,13-11- |
| InChIKey | ZDRYGISXVXGDQG-ZBVQHLLQSA-N |
| XLogP | 1.78 |
| TPSA | 189.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.91 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|