C28H35N7O10 — CID 131986627
4-[3-[5-carbamoyl-2-[[(E)-4-(4-carbamoyl-2-methoxy-6-nitroanilino)but-2-enyl]amino]-3-nitrophenoxy]propyl]piperidine-1-carboxylic acid (PubChem CID 131986627) has the molecular formula C28H35N7O10 and a molecular weight of 629.63 g/mol. Its IUPAC name is 4-[3-[5-carbamoyl-2-[[(E)-4-(4-carbamoyl-2-methoxy-6-nitroanilino)but-2-enyl]amino]-3-nitrophenoxy]propyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[3-[5-carbamoyl-2-[[(E)-4-(4-carbamoyl-2-methoxy-6-nitroanilino)but-2-enyl]amino]-3-nitrophenoxy]propyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 131986627 |
| Molecular Formula | C28H35N7O10 |
| Molecular Weight | 629.63 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | 4-[3-[5-carbamoyl-2-[[(E)-4-(4-carbamoyl-2-methoxy-6-nitroanilino)but-2-enyl]amino]-3-nitrophenoxy]propyl]piperidine-1-carboxylic acid |
| SMILES | COc1cc(C(N)=O)cc([N+](=O)[O-])c1NC/C=C/CNc1c(OCCCC2CCN(C(=O)O)CC2)cc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H35N7O10/c1-44-22-15-18(26(29)36)13-20(34(40)41)24(22)31-8-2-3-9-32-25-21(35(42)43)14-19(27(30)37)16-23(25)45-12-4-5-17-6-10-33(11-7-17)28(38)39/h2-3,13-17,31-32H,4-12H2,1H3,(H2,29,36)(H2,30,37)(H,38,39)/b3-2+ |
| InChIKey | GGSDJFOXHUSMNH-NSCUHMNNSA-N |
| XLogP | 3.34 |
| TPSA | 255.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|