C21H23N3O7 — CID 146346055
3-methoxy-5-nitro-4-[(1-phenylmethoxycarbonylpyrrolidin-3-yl)methylamino]benzoic acid (PubChem CID 146346055) has the molecular formula C21H23N3O7 and a molecular weight of 429.43 g/mol. Its IUPAC name is 3-methoxy-5-nitro-4-[(1-phenylmethoxycarbonylpyrrolidin-3-yl)methylamino]benzoic acid.
| Compound Name | 3-methoxy-5-nitro-4-[(1-phenylmethoxycarbonylpyrrolidin-3-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 146346055 |
| Molecular Formula | C21H23N3O7 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 3-methoxy-5-nitro-4-[(1-phenylmethoxycarbonylpyrrolidin-3-yl)methylamino]benzoic acid |
| SMILES | COc1cc(C(=O)O)cc([N+](=O)[O-])c1NCC1CCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H23N3O7/c1-30-18-10-16(20(25)26)9-17(24(28)29)19(18)22-11-15-7-8-23(12-15)21(27)31-13-14-5-3-2-4-6-14/h2-6,9-10,15,22H,7-8,11-13H2,1H3,(H,25,26) |
| InChIKey | DHFIZDJWVTXHMW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|