C16H21N3O2 — CID 134211472
benzyl (3S)-3-[(2-cyanoethylamino)methyl]pyrrolidine-1-carboxylate (PubChem CID 134211472) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is benzyl (3S)-3-[(2-cyanoethylamino)methyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (3S)-3-[(2-cyanoethylamino)methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 134211472 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | benzyl (3S)-3-[(2-cyanoethylamino)methyl]pyrrolidine-1-carboxylate |
| SMILES | N#CCCNC[C@@H]1CCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H21N3O2/c17-8-4-9-18-11-15-7-10-19(12-15)16(20)21-13-14-5-2-1-3-6-14/h1-3,5-6,15,18H,4,7,9-13H2/t15-/m0/s1 |
| InChIKey | ANTVHLOYRPJNBU-HNNXBMFYSA-N |
| XLogP | 2.15 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|