C14H13N3O6S — CID 108778300
3-[(2-nitro-4-sulfamoylanilino)methyl]benzoic acid (PubChem CID 108778300) has the molecular formula C14H13N3O6S and a molecular weight of 351.34 g/mol. Its IUPAC name is 3-[(2-nitro-4-sulfamoylanilino)methyl]benzoic acid.
| Compound Name | 3-[(2-nitro-4-sulfamoylanilino)methyl]benzoic acid |
|---|---|
| PubChem CID | 108778300 |
| Molecular Formula | C14H13N3O6S |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 3-[(2-nitro-4-sulfamoylanilino)methyl]benzoic acid |
| SMILES | NS(=O)(=O)c1ccc(NCc2cccc(C(=O)O)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13N3O6S/c15-24(22,23)11-4-5-12(13(7-11)17(20)21)16-8-9-2-1-3-10(6-9)14(18)19/h1-7,16H,8H2,(H,18,19)(H2,15,22,23) |
| InChIKey | RTSZSMUEOKAAEB-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 152.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|