C14H14N4O4S — CID 6116556
3-nitro-4-[(2Z)-2-(1-phenylethylidene)hydrazinyl]benzenesulfonamide (PubChem CID 6116556) has the molecular formula C14H14N4O4S and a molecular weight of 334.36 g/mol. Its IUPAC name is 3-nitro-4-[(2Z)-2-(1-phenylethylidene)hydrazinyl]benzenesulfonamide.
| Compound Name | 3-nitro-4-[(2Z)-2-(1-phenylethylidene)hydrazinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6116556 |
| Molecular Formula | C14H14N4O4S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 3-nitro-4-[(2Z)-2-(1-phenylethylidene)hydrazinyl]benzenesulfonamide |
| SMILES | C/C(=N/Nc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C14H14N4O4S/c1-10(11-5-3-2-4-6-11)16-17-13-8-7-12(23(15,21)22)9-14(13)18(19)20/h2-9,17H,1H3,(H2,15,21,22)/b16-10- |
| InChIKey | PLJXOKQYRWDMAL-YBEGLDIGSA-N |
| XLogP | 2.08 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|