C14H15N5O4S — CID 5219545
4-[2-[1-(4-aminophenyl)ethylidene]hydrazinyl]-3-nitrobenzenesulfonamide (PubChem CID 5219545) has the molecular formula C14H15N5O4S and a molecular weight of 349.37 g/mol. Its IUPAC name is 4-[2-[1-(4-aminophenyl)ethylidene]hydrazinyl]-3-nitrobenzenesulfonamide.
| Compound Name | 4-[2-[1-(4-aminophenyl)ethylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 5219545 |
| Molecular Formula | C14H15N5O4S |
| Molecular Weight | 349.37 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 4-[2-[1-(4-aminophenyl)ethylidene]hydrazinyl]-3-nitrobenzenesulfonamide |
| SMILES | CC(=NNc1ccc(S(N)(=O)=O)cc1[N+](=O)[O-])c1ccc(N)cc1 |
| InChI | InChI=1S/C14H15N5O4S/c1-9(10-2-4-11(15)5-3-10)17-18-13-7-6-12(24(16,22)23)8-14(13)19(20)21/h2-8,18H,15H2,1H3,(H2,16,22,23) |
| InChIKey | FKSYJSFJCGWVHK-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 153.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.37 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_anil(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|