C33H41N9O7 — CID 154942519
methyl 1-[(E)-4-[4-carbamoyl-2-(3-morpholin-4-ylpropoxy)-6-nitroanilino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazol-3-yl)amino]benzimidazole-5-carboxylate (PubChem CID 154942519) has the molecular formula C33H41N9O7 and a molecular weight of 675.75 g/mol. Its IUPAC name is methyl 1-[(E)-4-[4-carbamoyl-2-(3-morpholin-4-ylpropoxy)-6-nitroanilino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazol-3-yl)amino]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-[(E)-4-[4-carbamoyl-2-(3-morpholin-4-ylpropoxy)-6-nitroanilino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazol-3-yl)amino]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 154942519 |
| Molecular Formula | C33H41N9O7 |
| Molecular Weight | 675.75 g/mol |
| Exact Mass | 675.31 |
| IUPAC Name | methyl 1-[(E)-4-[4-carbamoyl-2-(3-morpholin-4-ylpropoxy)-6-nitroanilino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazol-3-yl)amino]benzimidazole-5-carboxylate |
| SMILES | CCn1nc(C)cc1Nc1nc2cc(C(=O)OC)ccc2n1C/C=C/CNc1c(OCCCN2CCOCC2)cc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C33H41N9O7/c1-4-41-29(18-22(2)38-41)37-33-36-25-19-23(32(44)47-3)8-9-26(25)40(33)12-6-5-10-35-30-27(42(45)46)20-24(31(34)43)21-28(30)49-15-7-11-39-13-16-48-17-14-39/h5-6,8-9,18-21,35H,4,7,10-17H2,1-3H3,(H2,34,43)(H,36,37)/b6-5+ |
| InChIKey | PXIKWFJWSWQVDV-AATRIKPKSA-N |
| XLogP | 3.87 |
| TPSA | 193.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.75 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|