C35H49N9O5Si — CID 175028396
1-[4-[2-amino-6-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-4-carbamoylanilino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazole-5-carboxamide (PubChem CID 175028396) has the molecular formula C35H49N9O5Si and a molecular weight of 703.92 g/mol. Its IUPAC name is 1-[4-[2-amino-6-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-4-carbamoylanilino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazole-5-carboxamide.
| Compound Name | 1-[4-[2-amino-6-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-4-carbamoylanilino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 175028396 |
| Molecular Formula | C35H49N9O5Si |
| Molecular Weight | 703.92 g/mol |
| Exact Mass | 703.36 |
| IUPAC Name | 1-[4-[2-amino-6-[3-[tert-butyl(dimethyl)silyl]oxypropoxy]-4-carbamoylanilino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]benzimidazole-5-carboxamide |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(C(N)=O)ccc2n1CC=CCNc1c(N)cc(C(N)=O)cc1OCCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H49N9O5Si/c1-8-44-28(18-22(2)42-44)33(47)41-34-40-26-20-23(31(37)45)12-13-27(26)43(34)15-10-9-14-39-30-25(36)19-24(32(38)46)21-29(30)48-16-11-17-49-50(6,7)35(3,4)5/h9-10,12-13,18-21,39H,8,11,14-17,36H2,1-7H3,(H2,37,45)(H2,38,46)(H,40,41,47) |
| InChIKey | CIZAIPFGNMSZDZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 207.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.92 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|