C35H46N10O7 — CID 164588020
tert-butyl N-[3-[3-amino-5-carbamoyl-2-[[(E)-4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazol-1-yl]but-2-enyl]amino]phenoxy]propyl]carbamate (PubChem CID 164588020) has the molecular formula C35H46N10O7 and a molecular weight of 718.82 g/mol. Its IUPAC name is tert-butyl N-[3-[3-amino-5-carbamoyl-2-[[(E)-4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazol-1-yl]but-2-enyl]amino]phenoxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[3-amino-5-carbamoyl-2-[[(E)-4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazol-1-yl]but-2-enyl]amino]phenoxy]propyl]carbamate |
|---|---|
| PubChem CID | 164588020 |
| Molecular Formula | C35H46N10O7 |
| Molecular Weight | 718.82 g/mol |
| Exact Mass | 718.36 |
| IUPAC Name | tert-butyl N-[3-[3-amino-5-carbamoyl-2-[[(E)-4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-methoxybenzimidazol-1-yl]but-2-enyl]amino]phenoxy]propyl]carbamate |
| SMILES | CCn1nc(C)cc1C(=O)Nc1nc2cc(C(N)=O)cc(OC)c2n1C/C=C/CNc1c(N)cc(C(N)=O)cc1OCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H46N10O7/c1-7-45-25(15-20(2)43-45)32(48)42-33-41-24-17-22(31(38)47)19-27(50-6)29(24)44(33)13-9-8-11-39-28-23(36)16-21(30(37)46)18-26(28)51-14-10-12-40-34(49)52-35(3,4)5/h8-9,15-19,39H,7,10-14,36H2,1-6H3,(H2,37,46)(H2,38,47)(H,40,49)(H,41,42,48)/b9-8+ |
| InChIKey | ZCMSZISTJWNXSG-CMDGGOBGSA-N |
| XLogP | 3.56 |
| TPSA | 245.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.82 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|