C32H50N8O7S — CID 171561248
tert-butyl N-[(E)-4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-(3-methylsulfanylpropoxy)benzimidazol-1-yl]but-2-enyl]carbamate;ethyl formate;methanamine (PubChem CID 171561248) has the molecular formula C32H50N8O7S and a molecular weight of 690.87 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-(3-methylsulfanylpropoxy)benzimidazol-1-yl]but-2-enyl]carbamate;ethyl formate;methanamine.
| Compound Name | tert-butyl N-[(E)-4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-(3-methylsulfanylpropoxy)benzimidazol-1-yl]but-2-enyl]carbamate;ethyl formate;methanamine |
|---|---|
| PubChem CID | 171561248 |
| Molecular Formula | C32H50N8O7S |
| Molecular Weight | 690.87 g/mol |
| Exact Mass | 690.35 |
| IUPAC Name | tert-butyl N-[(E)-4-[5-carbamoyl-2-[(2-ethyl-5-methylpyrazole-3-carbonyl)amino]-7-(3-methylsulfanylpropoxy)benzimidazol-1-yl]but-2-enyl]carbamate;ethyl formate;methanamine |
| SMILES | CCOC=O.CCn1nc(C)cc1C(=O)Nc1nc2cc(C(N)=O)cc(OCCCSC)c2n1C/C=C/CNC(=O)OC(C)(C)C.CN |
| InChI | InChI=1S/C28H39N7O5S.C3H6O2.CH5N/c1-7-35-21(15-18(2)33-35)25(37)32-26-31-20-16-19(24(29)36)17-22(39-13-10-14-41-6)23(20)34(26)12-9-8-11-30-27(38)40-28(3,4)5;1-2-5-3-4;1-2/h8-9,15-17H,7,10-14H2,1-6H3,(H2,29,36)(H,30,38)(H,31,32,37);3H,2H2,1H3;2H2,1H3/b9-8+;; |
| InChIKey | VPAQSXWZAUXSGB-YEUQMBKVSA-N |
| XLogP | 3.88 |
| TPSA | 207.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.87 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|