C33H43N9O5 — CID 154942487
methyl 1-[(E)-4-[2-amino-4-carbamoyl-6-(3-morpholin-4-ylpropoxy)anilino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazol-3-yl)amino]benzimidazole-5-carboxylate (PubChem CID 154942487) has the molecular formula C33H43N9O5 and a molecular weight of 645.77 g/mol. Its IUPAC name is methyl 1-[(E)-4-[2-amino-4-carbamoyl-6-(3-morpholin-4-ylpropoxy)anilino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazol-3-yl)amino]benzimidazole-5-carboxylate.
| Compound Name | methyl 1-[(E)-4-[2-amino-4-carbamoyl-6-(3-morpholin-4-ylpropoxy)anilino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazol-3-yl)amino]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 154942487 |
| Molecular Formula | C33H43N9O5 |
| Molecular Weight | 645.77 g/mol |
| Exact Mass | 645.34 |
| IUPAC Name | methyl 1-[(E)-4-[2-amino-4-carbamoyl-6-(3-morpholin-4-ylpropoxy)anilino]but-2-enyl]-2-[(2-ethyl-5-methylpyrazol-3-yl)amino]benzimidazole-5-carboxylate |
| SMILES | CCn1nc(C)cc1Nc1nc2cc(C(=O)OC)ccc2n1C/C=C/CNc1c(N)cc(C(N)=O)cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C33H43N9O5/c1-4-42-29(18-22(2)39-42)38-33-37-26-20-23(32(44)45-3)8-9-27(26)41(33)12-6-5-10-36-30-25(34)19-24(31(35)43)21-28(30)47-15-7-11-40-13-16-46-17-14-40/h5-6,8-9,18-21,36H,4,7,10-17,34H2,1-3H3,(H2,35,43)(H,37,38)/b6-5+ |
| InChIKey | OJEASZFZHNFPPP-AATRIKPKSA-N |
| XLogP | 3.54 |
| TPSA | 176.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.77 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|