C21H28N6O4 — CID 155786934
3-amino-4-[[(E)-4-(2-amino-4-carbamoylanilino)but-2-enyl]amino]-5-(3-hydroxypropoxy)benzamide (PubChem CID 155786934) has the molecular formula C21H28N6O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is 3-amino-4-[[(E)-4-(2-amino-4-carbamoylanilino)but-2-enyl]amino]-5-(3-hydroxypropoxy)benzamide.
| Compound Name | 3-amino-4-[[(E)-4-(2-amino-4-carbamoylanilino)but-2-enyl]amino]-5-(3-hydroxypropoxy)benzamide |
|---|---|
| PubChem CID | 155786934 |
| Molecular Formula | C21H28N6O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 3-amino-4-[[(E)-4-(2-amino-4-carbamoylanilino)but-2-enyl]amino]-5-(3-hydroxypropoxy)benzamide |
| SMILES | NC(=O)c1ccc(NC/C=C/CNc2c(N)cc(C(N)=O)cc2OCCCO)c(N)c1 |
| InChI | InChI=1S/C21H28N6O4/c22-15-10-13(20(24)29)4-5-17(15)26-6-1-2-7-27-19-16(23)11-14(21(25)30)12-18(19)31-9-3-8-28/h1-2,4-5,10-12,26-28H,3,6-9,22-23H2,(H2,24,29)(H2,25,30)/b2-1+ |
| InChIKey | NJLIFELKPKFNOM-OWOJBTEDSA-N |
| XLogP | 0.89 |
| TPSA | 191.74 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|