C20H24N4O5 — CID 175487153
4-[2-amino-4-carbamoyl-6-[(4-methoxyphenyl)methoxy]anilino]but-2-enyl carbamate (PubChem CID 175487153) has the molecular formula C20H24N4O5 and a molecular weight of 400.44 g/mol. Its IUPAC name is 4-[2-amino-4-carbamoyl-6-[(4-methoxyphenyl)methoxy]anilino]but-2-enyl carbamate.
| Compound Name | 4-[2-amino-4-carbamoyl-6-[(4-methoxyphenyl)methoxy]anilino]but-2-enyl carbamate |
|---|---|
| PubChem CID | 175487153 |
| Molecular Formula | C20H24N4O5 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-[2-amino-4-carbamoyl-6-[(4-methoxyphenyl)methoxy]anilino]but-2-enyl carbamate |
| SMILES | COc1ccc(COc2cc(C(N)=O)cc(N)c2NCC=CCOC(N)=O)cc1 |
| InChI | InChI=1S/C20H24N4O5/c1-27-15-6-4-13(5-7-15)12-29-17-11-14(19(22)25)10-16(21)18(17)24-8-2-3-9-28-20(23)26/h2-7,10-11,24H,8-9,12,21H2,1H3,(H2,22,25)(H2,23,26) |
| InChIKey | JVPNOCWBQYYZMK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 151.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|