C31H45N7O6 — CID 170983995
tert-butyl 4-[3-[3-amino-2-[[(E)-4-(2-amino-4-methoxycarbonylanilino)but-2-enyl]amino]-5-carbamoylphenoxy]propyl]piperazine-1-carboxylate (PubChem CID 170983995) has the molecular formula C31H45N7O6 and a molecular weight of 611.74 g/mol. Its IUPAC name is tert-butyl 4-[3-[3-amino-2-[[(E)-4-(2-amino-4-methoxycarbonylanilino)but-2-enyl]amino]-5-carbamoylphenoxy]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[3-amino-2-[[(E)-4-(2-amino-4-methoxycarbonylanilino)but-2-enyl]amino]-5-carbamoylphenoxy]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170983995 |
| Molecular Formula | C31H45N7O6 |
| Molecular Weight | 611.74 g/mol |
| Exact Mass | 611.34 |
| IUPAC Name | tert-butyl 4-[3-[3-amino-2-[[(E)-4-(2-amino-4-methoxycarbonylanilino)but-2-enyl]amino]-5-carbamoylphenoxy]propyl]piperazine-1-carboxylate |
| SMILES | COC(=O)c1ccc(NC/C=C/CNc2c(N)cc(C(N)=O)cc2OCCCN2CCN(C(=O)OC(C)(C)C)CC2)c(N)c1 |
| InChI | InChI=1S/C31H45N7O6/c1-31(2,3)44-30(41)38-15-13-37(14-16-38)12-7-17-43-26-20-22(28(34)39)19-24(33)27(26)36-11-6-5-10-35-25-9-8-21(18-23(25)32)29(40)42-4/h5-6,8-9,18-20,35-36H,7,10-17,32-33H2,1-4H3,(H2,34,39)/b6-5+ |
| InChIKey | CQXNUHBIGSWIPP-AATRIKPKSA-N |
| XLogP | 3.14 |
| TPSA | 187.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.74 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|