C24H39N5O3 — CID 178055485
tert-butyl 4-[4-(6-carbamoyl-3-methylindazol-1-yl)butyl]piperazine-1-carboxylate;ethane (PubChem CID 178055485) has the molecular formula C24H39N5O3 and a molecular weight of 445.61 g/mol. Its IUPAC name is tert-butyl 4-[4-(6-carbamoyl-3-methylindazol-1-yl)butyl]piperazine-1-carboxylate;ethane.
| Compound Name | tert-butyl 4-[4-(6-carbamoyl-3-methylindazol-1-yl)butyl]piperazine-1-carboxylate;ethane |
|---|---|
| PubChem CID | 178055485 |
| Molecular Formula | C24H39N5O3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | tert-butyl 4-[4-(6-carbamoyl-3-methylindazol-1-yl)butyl]piperazine-1-carboxylate;ethane |
| SMILES | CC.Cc1nn(CCCCN2CCN(C(=O)OC(C)(C)C)CC2)c2cc(C(N)=O)ccc12 |
| InChI | InChI=1S/C22H33N5O3.C2H6/c1-16-18-8-7-17(20(23)28)15-19(18)27(24-16)10-6-5-9-25-11-13-26(14-12-25)21(29)30-22(2,3)4;1-2/h7-8,15H,5-6,9-14H2,1-4H3,(H2,23,28);1-2H3 |
| InChIKey | MXSQDWJONZVADF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|