About tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate
tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 55960777) has the molecular formula C19H32ClN5O3
and a molecular weight of 413.95 g/mol. Its IUPAC name is tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate |
| PubChem CID | 55960777 |
| Molecular Formula | C19H32ClN5O3 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | Cc1nn(CC(=O)NCCCN2CCN(C(=O)OC(C)(C)C)CC2)c(C)c1Cl |
| InChI | InChI=1S/C19H32ClN5O3/c1-14-17(20)15(2)25(22-14)13-16(26)21-7-6-8-23-9-11-24(12-10-23)18(27)28-19(3,4)5/h6-13H2,1-5H3,(H,21,26) |
| InChIKey | OSQHCSAUXYJPEN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate?
The IUPAC name of tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate (CID 55960777) is tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate is Cc1nn(CC(=O)NCCCN2CCN(C(=O)OC(C)(C)C)CC2)c(C)c1Cl.
What is the InChIKey of tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate?
The InChIKey is OSQHCSAUXYJPEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32ClN5O3/c1-14-17(20)15(2)25(22-14)13-16(26)21-7-6-8-23-9-11-24(12-10-23)18(27)28-19(3,4)5/h6-13H2,1-5H3,(H,21,26).
What are the key properties of tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate?
tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate has a molecular weight of 413.95 g/mol, XLogP of 2.21, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[3-[[2-(4-chloro-3,5-dimethylpyrazol-1-yl)acetyl]amino]propyl]piperazine-1-carboxylate is sourced from PubChem (CID 55960777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).