C35H52N8O6 — CID 178003378
tert-butyl N-[1-[3-[3-amino-2-[[(E)-4-[4-carbamoyl-2-methoxy-N-(methylaminomethyl)-6-(methylideneamino)anilino]but-2-enyl]amino]-5-formylphenoxy]propyl]piperidin-4-yl]carbamate (PubChem CID 178003378) has the molecular formula C35H52N8O6 and a molecular weight of 680.85 g/mol. Its IUPAC name is tert-butyl N-[1-[3-[3-amino-2-[[(E)-4-[4-carbamoyl-2-methoxy-N-(methylaminomethyl)-6-(methylideneamino)anilino]but-2-enyl]amino]-5-formylphenoxy]propyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[3-[3-amino-2-[[(E)-4-[4-carbamoyl-2-methoxy-N-(methylaminomethyl)-6-(methylideneamino)anilino]but-2-enyl]amino]-5-formylphenoxy]propyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 178003378 |
| Molecular Formula | C35H52N8O6 |
| Molecular Weight | 680.85 g/mol |
| Exact Mass | 680.40 |
| IUPAC Name | tert-butyl N-[1-[3-[3-amino-2-[[(E)-4-[4-carbamoyl-2-methoxy-N-(methylaminomethyl)-6-(methylideneamino)anilino]but-2-enyl]amino]-5-formylphenoxy]propyl]piperidin-4-yl]carbamate |
| SMILES | C=Nc1cc(C(N)=O)cc(OC)c1N(C/C=C/CNc1c(N)cc(C=O)cc1OCCCN1CCC(NC(=O)OC(C)(C)C)CC1)CNC |
| InChI | InChI=1S/C35H52N8O6/c1-35(2,3)49-34(46)41-26-10-15-42(16-11-26)13-9-17-48-29-19-24(22-44)18-27(36)31(29)40-12-7-8-14-43(23-38-4)32-28(39-5)20-25(33(37)45)21-30(32)47-6/h7-8,18-22,26,38,40H,5,9-17,23,36H2,1-4,6H3,(H2,37,45)(H,41,46)/b8-7+ |
| InChIKey | NKLPSTRWUDBJOW-BQYQJAHWSA-N |
| XLogP | 3.93 |
| TPSA | 185.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.85 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|