C36H42N6O7 — CID 178003360
tert-butyl N-[3-[(E)-4-[3-amino-5-formyl-2-[[(E)-4-[5-formyl-7-methoxy-2-(methylamino)benzimidazol-1-yl]but-2-enyl]amino]phenoxy]but-2-enoxy]phenyl]carbamate (PubChem CID 178003360) has the molecular formula C36H42N6O7 and a molecular weight of 670.77 g/mol. Its IUPAC name is tert-butyl N-[3-[(E)-4-[3-amino-5-formyl-2-[[(E)-4-[5-formyl-7-methoxy-2-(methylamino)benzimidazol-1-yl]but-2-enyl]amino]phenoxy]but-2-enoxy]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[(E)-4-[3-amino-5-formyl-2-[[(E)-4-[5-formyl-7-methoxy-2-(methylamino)benzimidazol-1-yl]but-2-enyl]amino]phenoxy]but-2-enoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 178003360 |
| Molecular Formula | C36H42N6O7 |
| Molecular Weight | 670.77 g/mol |
| Exact Mass | 670.31 |
| IUPAC Name | tert-butyl N-[3-[(E)-4-[3-amino-5-formyl-2-[[(E)-4-[5-formyl-7-methoxy-2-(methylamino)benzimidazol-1-yl]but-2-enyl]amino]phenoxy]but-2-enoxy]phenyl]carbamate |
| SMILES | CNc1nc2cc(C=O)cc(OC)c2n1C/C=C/CNc1c(N)cc(C=O)cc1OC/C=C/COc1cccc(NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C36H42N6O7/c1-36(2,3)49-35(45)40-26-11-10-12-27(21-26)47-15-8-9-16-48-30-19-24(22-43)17-28(37)32(30)39-13-6-7-14-42-33-29(41-34(42)38-4)18-25(23-44)20-31(33)46-5/h6-12,17-23,39H,13-16,37H2,1-5H3,(H,38,41)(H,40,45)/b7-6+,9-8+ |
| InChIKey | FLGRLYRSDDNJHO-BLHCBFLLSA-N |
| XLogP | 6.32 |
| TPSA | 168.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.77 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|