C39H46FN2O5P — CID 159909427
tert-butyl 4-[3-(4-ethoxycarbonyl-2-fluorophenoxy)propyl]piperazine-1-carboxylate;triphenylphosphane (PubChem CID 159909427) has the molecular formula C39H46FN2O5P and a molecular weight of 672.78 g/mol. Its IUPAC name is tert-butyl 4-[3-(4-ethoxycarbonyl-2-fluorophenoxy)propyl]piperazine-1-carboxylate;triphenylphosphane.
| Compound Name | tert-butyl 4-[3-(4-ethoxycarbonyl-2-fluorophenoxy)propyl]piperazine-1-carboxylate;triphenylphosphane |
|---|---|
| PubChem CID | 159909427 |
| Molecular Formula | C39H46FN2O5P |
| Molecular Weight | 672.78 g/mol |
| Exact Mass | 672.31 |
| IUPAC Name | tert-butyl 4-[3-(4-ethoxycarbonyl-2-fluorophenoxy)propyl]piperazine-1-carboxylate;triphenylphosphane |
| SMILES | CCOC(=O)c1ccc(OCCCN2CCN(C(=O)OC(C)(C)C)CC2)c(F)c1.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H31FN2O5.C18H15P/c1-5-27-19(25)16-7-8-18(17(22)15-16)28-14-6-9-23-10-12-24(13-11-23)20(26)29-21(2,3)4;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h7-8,15H,5-6,9-14H2,1-4H3;1-15H |
| InChIKey | NWZLBDQIUNLBED-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.78 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|