C23H35N3O7 — CID 165371056
tert-butyl 4-[3-[3-[4-(hydroperoxyamino)benzoyl]oxycyclobutyl]oxypropyl]piperazine-1-carboxylate (PubChem CID 165371056) has the molecular formula C23H35N3O7 and a molecular weight of 465.55 g/mol. Its IUPAC name is tert-butyl 4-[3-[3-[4-(hydroperoxyamino)benzoyl]oxycyclobutyl]oxypropyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[3-[4-(hydroperoxyamino)benzoyl]oxycyclobutyl]oxypropyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 165371056 |
| Molecular Formula | C23H35N3O7 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | tert-butyl 4-[3-[3-[4-(hydroperoxyamino)benzoyl]oxycyclobutyl]oxypropyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCOC2CC(OC(=O)c3ccc(NOO)cc3)C2)CC1 |
| InChI | InChI=1S/C23H35N3O7/c1-23(2,3)32-22(28)26-12-10-25(11-13-26)9-4-14-30-19-15-20(16-19)31-21(27)17-5-7-18(8-6-17)24-33-29/h5-8,19-20,24,29H,4,9-16H2,1-3H3 |
| InChIKey | KVCFJPVVZADLJR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|