C22H33N3O5 — CID 174426041
tert-butyl 4-[[4-(4-ethoxy-4-oxobutyl)piperazine-1-carbonyl]amino]benzoate (PubChem CID 174426041) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is tert-butyl 4-[[4-(4-ethoxy-4-oxobutyl)piperazine-1-carbonyl]amino]benzoate.
| Compound Name | tert-butyl 4-[[4-(4-ethoxy-4-oxobutyl)piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 174426041 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | tert-butyl 4-[[4-(4-ethoxy-4-oxobutyl)piperazine-1-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)CCCN1CCN(C(=O)Nc2ccc(C(=O)OC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C22H33N3O5/c1-5-29-19(26)7-6-12-24-13-15-25(16-14-24)21(28)23-18-10-8-17(9-11-18)20(27)30-22(2,3)4/h8-11H,5-7,12-16H2,1-4H3,(H,23,28) |
| InChIKey | AZWODNNEBWOAJB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |