C22H30N4O2 — CID 138620623
tert-butyl 4-[(3-amino-4-anilinophenyl)methyl]piperazine-1-carboxylate (PubChem CID 138620623) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is tert-butyl 4-[(3-amino-4-anilinophenyl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(3-amino-4-anilinophenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 138620623 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | tert-butyl 4-[(3-amino-4-anilinophenyl)methyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(Cc2ccc(Nc3ccccc3)c(N)c2)CC1 |
| InChI | InChI=1S/C22H30N4O2/c1-22(2,3)28-21(27)26-13-11-25(12-14-26)16-17-9-10-20(19(23)15-17)24-18-7-5-4-6-8-18/h4-10,15,24H,11-14,16,23H2,1-3H3 |
| InChIKey | OGBRZBPHRZRQFQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|