C19H28N4O3 — CID 90333983
tert-butyl 4-[[4-amino-3-(prop-2-enoylamino)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 90333983) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is tert-butyl 4-[[4-amino-3-(prop-2-enoylamino)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-amino-3-(prop-2-enoylamino)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 90333983 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | tert-butyl 4-[[4-amino-3-(prop-2-enoylamino)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | C=CC(=O)Nc1cc(CN2CCN(C(=O)OC(C)(C)C)CC2)ccc1N |
| InChI | InChI=1S/C19H28N4O3/c1-5-17(24)21-16-12-14(6-7-15(16)20)13-22-8-10-23(11-9-22)18(25)26-19(2,3)4/h5-7,12H,1,8-11,13,20H2,2-4H3,(H,21,24) |
| InChIKey | ICZQPTLYQKGUCK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|