C17H24N4O2 — CID 90333250
N-[5-[(4-acetyl-2-methylpiperazin-1-yl)methyl]-2-aminophenyl]prop-2-enamide (PubChem CID 90333250) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is N-[5-[(4-acetyl-2-methylpiperazin-1-yl)methyl]-2-aminophenyl]prop-2-enamide.
| Compound Name | N-[5-[(4-acetyl-2-methylpiperazin-1-yl)methyl]-2-aminophenyl]prop-2-enamide |
|---|---|
| PubChem CID | 90333250 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | N-[5-[(4-acetyl-2-methylpiperazin-1-yl)methyl]-2-aminophenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(CN2CCN(C(C)=O)CC2C)ccc1N |
| InChI | InChI=1S/C17H24N4O2/c1-4-17(23)19-16-9-14(5-6-15(16)18)11-20-7-8-21(13(3)22)10-12(20)2/h4-6,9,12H,1,7-8,10-11,18H2,2-3H3,(H,19,23) |
| InChIKey | YKILHFZGRFLGJB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|