C13H16BrClN2O2 — CID 135387982
(3S)-4-[(3-bromo-4-chlorophenyl)methyl]-3-methylpiperazine-1-carboxylic acid (PubChem CID 135387982) has the molecular formula C13H16BrClN2O2 and a molecular weight of 347.64 g/mol. Its IUPAC name is (3S)-4-[(3-bromo-4-chlorophenyl)methyl]-3-methylpiperazine-1-carboxylic acid.
| Compound Name | (3S)-4-[(3-bromo-4-chlorophenyl)methyl]-3-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 135387982 |
| Molecular Formula | C13H16BrClN2O2 |
| Molecular Weight | 347.64 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | (3S)-4-[(3-bromo-4-chlorophenyl)methyl]-3-methylpiperazine-1-carboxylic acid |
| SMILES | C[C@H]1CN(C(=O)O)CCN1Cc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C13H16BrClN2O2/c1-9-7-17(13(18)19)5-4-16(9)8-10-2-3-12(15)11(14)6-10/h2-3,6,9H,4-5,7-8H2,1H3,(H,18,19)/t9-/m0/s1 |
| InChIKey | CVFYTFLUHWDZPK-VIFPVBQESA-N |
| XLogP | 3.29 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.64 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |