C14H17BrClNO2 — CID 83240966
2-[1-[(3-bromo-4-chlorophenyl)methyl]piperidin-2-yl]acetic acid (PubChem CID 83240966) has the molecular formula C14H17BrClNO2 and a molecular weight of 346.65 g/mol. Its IUPAC name is 2-[1-[(3-bromo-4-chlorophenyl)methyl]piperidin-2-yl]acetic acid.
| Compound Name | 2-[1-[(3-bromo-4-chlorophenyl)methyl]piperidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 83240966 |
| Molecular Formula | C14H17BrClNO2 |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 2-[1-[(3-bromo-4-chlorophenyl)methyl]piperidin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CCCCN1Cc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H17BrClNO2/c15-12-7-10(4-5-13(12)16)9-17-6-2-1-3-11(17)8-14(18)19/h4-5,7,11H,1-3,6,8-9H2,(H,18,19) |
| InChIKey | QSHLBQJWABOEJA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |