C14H20BrClN2 — CID 83230799
2-[1-[(3-bromo-4-chlorophenyl)methyl]piperidin-2-yl]ethanamine (PubChem CID 83230799) has the molecular formula C14H20BrClN2 and a molecular weight of 331.69 g/mol. Its IUPAC name is 2-[1-[(3-bromo-4-chlorophenyl)methyl]piperidin-2-yl]ethanamine.
| Compound Name | 2-[1-[(3-bromo-4-chlorophenyl)methyl]piperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 83230799 |
| Molecular Formula | C14H20BrClN2 |
| Molecular Weight | 331.69 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2-[1-[(3-bromo-4-chlorophenyl)methyl]piperidin-2-yl]ethanamine |
| SMILES | NCCC1CCCCN1Cc1ccc(Cl)c(Br)c1 |
| InChI | InChI=1S/C14H20BrClN2/c15-13-9-11(4-5-14(13)16)10-18-8-2-1-3-12(18)6-7-17/h4-5,9,12H,1-3,6-8,10,17H2 |
| InChIKey | JNWDQAVANIPJKZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.69 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |