C12H19BrN2O — CID 106885961
2-[1-[(3-bromofuran-2-yl)methyl]piperidin-2-yl]ethanamine (PubChem CID 106885961) has the molecular formula C12H19BrN2O and a molecular weight of 287.20 g/mol. Its IUPAC name is 2-[1-[(3-bromofuran-2-yl)methyl]piperidin-2-yl]ethanamine.
| Compound Name | 2-[1-[(3-bromofuran-2-yl)methyl]piperidin-2-yl]ethanamine |
|---|---|
| PubChem CID | 106885961 |
| Molecular Formula | C12H19BrN2O |
| Molecular Weight | 287.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 2-[1-[(3-bromofuran-2-yl)methyl]piperidin-2-yl]ethanamine |
| SMILES | NCCC1CCCCN1Cc1occc1Br |
| InChI | InChI=1S/C12H19BrN2O/c13-11-5-8-16-12(11)9-15-7-2-1-3-10(15)4-6-14/h5,8,10H,1-4,6-7,9,14H2 |
| InChIKey | VQEPAABIXNLMBF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.20 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |