C13H19BrN2O — CID 106885940
1-[(3-bromofuran-2-yl)methyl]-2-pyrrolidin-2-ylpyrrolidine (PubChem CID 106885940) has the molecular formula C13H19BrN2O and a molecular weight of 299.21 g/mol. Its IUPAC name is 1-[(3-bromofuran-2-yl)methyl]-2-pyrrolidin-2-ylpyrrolidine.
| Compound Name | 1-[(3-bromofuran-2-yl)methyl]-2-pyrrolidin-2-ylpyrrolidine |
|---|---|
| PubChem CID | 106885940 |
| Molecular Formula | C13H19BrN2O |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-[(3-bromofuran-2-yl)methyl]-2-pyrrolidin-2-ylpyrrolidine |
| SMILES | Brc1ccoc1CN1CCCC1C1CCCN1 |
| InChI | InChI=1S/C13H19BrN2O/c14-10-5-8-17-13(10)9-16-7-2-4-12(16)11-3-1-6-15-11/h5,8,11-12,15H,1-4,6-7,9H2 |
| InChIKey | SHLIMDFHIFFIPU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |