C12H18N2O — CID 102571327
4-(furan-2-ylmethyl)-1,2,3,4a,5,6,7,7a-octahydrocyclopenta[b]pyrazine (PubChem CID 102571327) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-(furan-2-ylmethyl)-1,2,3,4a,5,6,7,7a-octahydrocyclopenta[b]pyrazine.
| Compound Name | 4-(furan-2-ylmethyl)-1,2,3,4a,5,6,7,7a-octahydrocyclopenta[b]pyrazine |
|---|---|
| PubChem CID | 102571327 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 4-(furan-2-ylmethyl)-1,2,3,4a,5,6,7,7a-octahydrocyclopenta[b]pyrazine |
| SMILES | c1coc(CN2CCNC3CCCC32)c1 |
| InChI | InChI=1S/C12H18N2O/c1-4-11-12(5-1)14(7-6-13-11)9-10-3-2-8-15-10/h2-3,8,11-13H,1,4-7,9H2 |
| InChIKey | MTDIBQMZBJQULT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |