C10H16N2O — CID 94011431
[(2R)-1-(furan-2-ylmethyl)pyrrolidin-2-yl]methanamine (PubChem CID 94011431) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is [(2R)-1-(furan-2-ylmethyl)pyrrolidin-2-yl]methanamine.
| Compound Name | [(2R)-1-(furan-2-ylmethyl)pyrrolidin-2-yl]methanamine |
|---|---|
| PubChem CID | 94011431 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | [(2R)-1-(furan-2-ylmethyl)pyrrolidin-2-yl]methanamine |
| SMILES | NC[C@H]1CCCN1Cc1ccco1 |
| InChI | InChI=1S/C10H16N2O/c11-7-9-3-1-5-12(9)8-10-4-2-6-13-10/h2,4,6,9H,1,3,5,7-8,11H2/t9-/m1/s1 |
| InChIKey | ABUHPAKPSQRFRL-SECBINFHSA-N |
| XLogP | 1.20 |
| TPSA | 42.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |